USD82402S - Design por a door pull - Google Patents

Design por a door pull Download PDF

Info

Application number

Other languages

Inventor

Otto E. Tthlmann

Filing date

1930-08-13

Publication date

1930-10-28

KCAFJFCATBRIMJ-UHFFFAOYSA-N 4,4-diphenyl-5-oxa-3-oxonia-4-boranuidabicyclo[4.4.0]deca-1(10),2,6,8-tetraene Chemical compound O1C2=CC=CC=C2C=[O+][B-]1(C=1C=CC=CC=1)C1=CC=CC=C1 KCAFJFCATBRIMJ-UHFFFAOYSA-N 0.000 description 2
244000017545 hariali grass Species 0.000 description 2

Publication	Publication Date	Title
USD82402S (en)	1930-10-28	Design por a door pull
USD84019S (en)	1931-04-21	Design for a door pull
USD84769S (en)	1931-07-28	Design for a handle for a door of an automobile or the like
USD84770S (en)	1931-07-28	Design for a handle for a door of an automobile or the like
USD99317S (en)	1936-04-14	Design fob a drawer pull or
USD73640S (en)	1927-10-18	Design for a drawer pull
USD72798S (en)	1927-06-07	Design for a drawer pull
USD82403S (en)	1930-10-28	Design for a door pull
USD99907S (en)	1936-06-02	Design for a drawer pull or
USD94795S (en)	1935-03-05	Design fob a handle or similar
USD93859S (en)	1934-11-13	Design fob a can opener
USD99046S (en)	1936-03-24	Design for a drawer pull or similar
USD99022S (en)	1936-03-24	Design for a drawer pull or
USD81312S (en)	1930-06-03	Gobdon e
USD98693S (en)	1936-02-25	Design for a drawer pull or similar
USD97208S (en)	1935-10-15	Design fob a door handle
USD74751S (en)	1928-03-20	Design for a casket handle
USD75534S (en)	1928-06-12	Design for a door lock
USD81552S (en)	1930-07-08	Design for a latch
USD73231S (en)	1927-08-09	Design for a morris-chair frame
USD74095S (en)	1927-12-20	Design for a base plate for a drawer pttll
USD63281S (en)	1923-11-20	Design for an end table
USD65123S (en)	1924-07-08	Design for a spoon or similar article
USD82040S (en)	1930-09-16	Design fob a shrine
USD92931S (en)	1934-07-31	Design fob a hinge for cabinet doors